C14H26OSi — CID 101231318
(3E)-2-tri(propan-2-yl)silylpenta-1,3-dien-1-one (PubChem CID 101231318) has the molecular formula C14H26OSi and a molecular weight of 238.45 g/mol. Its IUPAC name is (3E)-2-tri(propan-2-yl)silylpenta-1,3-dien-1-one.
| Compound Name | (3E)-2-tri(propan-2-yl)silylpenta-1,3-dien-1-one |
|---|---|
| PubChem CID | 101231318 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (3E)-2-tri(propan-2-yl)silylpenta-1,3-dien-1-one |
| SMILES | C/C=C/C(=C=O)[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H26OSi/c1-8-9-14(10-15)16(11(2)3,12(4)5)13(6)7/h8-9,11-13H,1-7H3/b9-8+ |
| InChIKey | RRYYMYNCPUWDAX-CMDGGOBGSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|