C11H22OSi2 — CID 10799292
(3E)-2,3-bis(trimethylsilyl)penta-1,3-dien-1-one (PubChem CID 10799292) has the molecular formula C11H22OSi2 and a molecular weight of 226.47 g/mol. Its IUPAC name is (3E)-2,3-bis(trimethylsilyl)penta-1,3-dien-1-one.
| Compound Name | (3E)-2,3-bis(trimethylsilyl)penta-1,3-dien-1-one |
|---|---|
| PubChem CID | 10799292 |
| Molecular Formula | C11H22OSi2 |
| Molecular Weight | 226.47 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (3E)-2,3-bis(trimethylsilyl)penta-1,3-dien-1-one |
| SMILES | C/C=C(\C(=C=O)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C11H22OSi2/c1-8-10(13(2,3)4)11(9-12)14(5,6)7/h8H,1-7H3/b10-8+ |
| InChIKey | KMILMWDWZYQKIZ-CSKARUKUSA-N |
| XLogP | 3.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|