C14H28OSi3 — CID 15273819
2,3,5-tris(trimethylsilyl)penta-1,3,4-trien-1-one (PubChem CID 15273819) has the molecular formula C14H28OSi3 and a molecular weight of 296.64 g/mol. Its IUPAC name is 2,3,5-tris(trimethylsilyl)penta-1,3,4-trien-1-one.
| Compound Name | 2,3,5-tris(trimethylsilyl)penta-1,3,4-trien-1-one |
|---|---|
| PubChem CID | 15273819 |
| Molecular Formula | C14H28OSi3 |
| Molecular Weight | 296.64 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2,3,5-tris(trimethylsilyl)penta-1,3,4-trien-1-one |
| SMILES | C[Si](C)(C)C=C=C(C(=C=O)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H28OSi3/c1-16(2,3)11-10-13(17(4,5)6)14(12-15)18(7,8)9/h11H,1-9H3 |
| InChIKey | KZTFVJQXOPPCTA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.64 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|