C16H26NNaO13 — CID 101231406
sodium (E)-4-hydroxy-4-oxo-N-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]but-2-enimidate (PubChem CID 101231406) has the molecular formula C16H26NNaO13 and a molecular weight of 463.37 g/mol. Its IUPAC name is sodium (E)-4-hydroxy-4-oxo-N-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]but-2-enimidate.
| Compound Name | sodium (E)-4-hydroxy-4-oxo-N-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]but-2-enimidate |
|---|---|
| PubChem CID | 101231406 |
| Molecular Formula | C16H26NNaO13 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | sodium (E)-4-hydroxy-4-oxo-N-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]but-2-enimidate |
| SMILES | O=C(O)/C=C/C([O-])=N/C[C@H](O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)CO.[Na+] |
| InChI | InChI=1S/C16H27NO13.Na/c18-4-7(21)15(11(25)6(20)3-17-9(22)1-2-10(23)24)30-16-14(28)13(27)12(26)8(5-19)29-16;/h1-2,6-8,11-16,18-21,25-28H,3-5H2,(H,17,22)(H,23,24);/q;+1/p-1/b2-1+;/t6-,7+,8+,11+,12-,13-,14+,15+,16-;/m0./s1 |
| InChIKey | KUCPHPZBRTXDBU-JNYUVOIMSA-M |
| XLogP | -9.35 |
| TPSA | 253.02 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | -9.35 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|