C22H25NO6 — CID 101232084
2-[(4aR,7S,8R,8aS)-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-N-phenylmethoxyacetamide (PubChem CID 101232084) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-[(4aR,7S,8R,8aS)-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-N-phenylmethoxyacetamide.
| Compound Name | 2-[(4aR,7S,8R,8aS)-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 101232084 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[(4aR,7S,8R,8aS)-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-N-phenylmethoxyacetamide |
| SMILES | O=C(C[C@H]1CO[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1O)NOCc1ccccc1 |
| InChI | InChI=1S/C22H25NO6/c24-19(23-28-12-15-7-3-1-4-8-15)11-17-13-26-18-14-27-22(29-21(18)20(17)25)16-9-5-2-6-10-16/h1-10,17-18,20-22,25H,11-14H2,(H,23,24)/t17-,18+,20+,21+,22?/m0/s1 |
| InChIKey | CGKUILJRPYMYFR-YIGDCSIHSA-N |
| XLogP | 2.11 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|