C14H19BrO5 — CID 101232108
ethyl (2E)-6-bromo-3-[(E)-3-ethoxy-3-oxoprop-1-enoxy]hepta-2,6-dienoate (PubChem CID 101232108) has the molecular formula C14H19BrO5 and a molecular weight of 347.21 g/mol. Its IUPAC name is ethyl (2E)-6-bromo-3-[(E)-3-ethoxy-3-oxoprop-1-enoxy]hepta-2,6-dienoate.
| Compound Name | ethyl (2E)-6-bromo-3-[(E)-3-ethoxy-3-oxoprop-1-enoxy]hepta-2,6-dienoate |
|---|---|
| PubChem CID | 101232108 |
| Molecular Formula | C14H19BrO5 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | ethyl (2E)-6-bromo-3-[(E)-3-ethoxy-3-oxoprop-1-enoxy]hepta-2,6-dienoate |
| SMILES | C=C(Br)CC/C(=C\C(=O)OCC)O/C=C/C(=O)OCC |
| InChI | InChI=1S/C14H19BrO5/c1-4-18-13(16)8-9-20-12(7-6-11(3)15)10-14(17)19-5-2/h8-10H,3-7H2,1-2H3/b9-8+,12-10+ |
| InChIKey | HIUGRBODZPADDW-CDKJVOIVSA-N |
| XLogP | 3.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|