C16H22Br2O4 — CID 5372500
(3E,11E)-5,13-dibromo-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione (PubChem CID 5372500) has the molecular formula C16H22Br2O4 and a molecular weight of 438.16 g/mol. Its IUPAC name is (3E,11E)-5,13-dibromo-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione.
| Compound Name | (3E,11E)-5,13-dibromo-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione |
|---|---|
| PubChem CID | 5372500 |
| Molecular Formula | C16H22Br2O4 |
| Molecular Weight | 438.16 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | (3E,11E)-5,13-dibromo-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione |
| SMILES | CC1CCC(Br)/C=C/C(=O)OC(C)CCC(Br)/C=C/C(=O)O1 |
| InChI | InChI=1S/C16H22Br2O4/c1-11-3-5-13(17)8-10-16(20)22-12(2)4-6-14(18)7-9-15(19)21-11/h7-14H,3-6H2,1-2H3/b9-7+,10-8+ |
| InChIKey | LNCQFQKPKHAFEA-FIFLTTCUSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.16 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|