C15H21O4- — CID 166444958
(3E,5S,6Z,8S,9Z,14S)-8-methoxy-14-methyl-2-oxo-1-oxacyclotetradeca-3,6,9-trien-5-olate (PubChem CID 166444958) has the molecular formula C15H21O4- and a molecular weight of 265.33 g/mol. Its IUPAC name is (3E,5S,6Z,8S,9Z,14S)-8-methoxy-14-methyl-2-oxo-1-oxacyclotetradeca-3,6,9-trien-5-olate.
| Compound Name | (3E,5S,6Z,8S,9Z,14S)-8-methoxy-14-methyl-2-oxo-1-oxacyclotetradeca-3,6,9-trien-5-olate |
|---|---|
| PubChem CID | 166444958 |
| Molecular Formula | C15H21O4- |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | (3E,5S,6Z,8S,9Z,14S)-8-methoxy-14-methyl-2-oxo-1-oxacyclotetradeca-3,6,9-trien-5-olate |
| SMILES | CO[C@H]1/C=C\CCC[C@H](C)OC(=O)/C=C/[C@@H]([O-])/C=C\1 |
| InChI | InChI=1S/C15H21O4/c1-12-6-4-3-5-7-14(18-2)10-8-13(16)9-11-15(17)19-12/h5,7-14H,3-4,6H2,1-2H3/q-1/b7-5-,10-8-,11-9+/t12-,13-,14-/m0/s1 |
| InChIKey | ODTOHFVRKDUCGY-YGJWGCTESA-N |
| XLogP | 1.51 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|