C24H33N3O7 — CID 101233842
(4S,7S,14Z)-6-[(1S)-1-(3-methoxyphenyl)ethyl]-4-methyl-7-propan-2-yl-1,12-dioxa-3,6,9-triazacyclohexadec-14-ene-2,5,8,11-tetrone (PubChem CID 101233842) has the molecular formula C24H33N3O7 and a molecular weight of 475.54 g/mol. Its IUPAC name is (4S,7S,14Z)-6-[(1S)-1-(3-methoxyphenyl)ethyl]-4-methyl-7-propan-2-yl-1,12-dioxa-3,6,9-triazacyclohexadec-14-ene-2,5,8,11-tetrone.
| Compound Name | (4S,7S,14Z)-6-[(1S)-1-(3-methoxyphenyl)ethyl]-4-methyl-7-propan-2-yl-1,12-dioxa-3,6,9-triazacyclohexadec-14-ene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 101233842 |
| Molecular Formula | C24H33N3O7 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | (4S,7S,14Z)-6-[(1S)-1-(3-methoxyphenyl)ethyl]-4-methyl-7-propan-2-yl-1,12-dioxa-3,6,9-triazacyclohexadec-14-ene-2,5,8,11-tetrone |
| SMILES | COc1cccc([C@H](C)N2C(=O)[C@H](C)NC(=O)OC/C=C\COC(=O)CNC(=O)[C@@H]2C(C)C)c1 |
| InChI | InChI=1S/C24H33N3O7/c1-15(2)21-22(29)25-14-20(28)33-11-6-7-12-34-24(31)26-16(3)23(30)27(21)17(4)18-9-8-10-19(13-18)32-5/h6-10,13,15-17,21H,11-12,14H2,1-5H3,(H,25,29)(H,26,31)/b7-6-/t16-,17-,21-/m0/s1 |
| InChIKey | JMAOYWCDLQLPFU-RRXZQZRWSA-N |
| XLogP | 1.95 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|