C13H22O6 — CID 101234063
[(2S,4S)-2-(2-methoxyethoxymethoxymethyl)-5-methyl-3,4-dihydro-2H-pyran-4-yl] acetate (PubChem CID 101234063) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is [(2S,4S)-2-(2-methoxyethoxymethoxymethyl)-5-methyl-3,4-dihydro-2H-pyran-4-yl] acetate.
| Compound Name | [(2S,4S)-2-(2-methoxyethoxymethoxymethyl)-5-methyl-3,4-dihydro-2H-pyran-4-yl] acetate |
|---|---|
| PubChem CID | 101234063 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [(2S,4S)-2-(2-methoxyethoxymethoxymethyl)-5-methyl-3,4-dihydro-2H-pyran-4-yl] acetate |
| SMILES | COCCOCOC[C@@H]1C[C@H](OC(C)=O)C(C)=CO1 |
| InChI | InChI=1S/C13H22O6/c1-10-7-18-12(6-13(10)19-11(2)14)8-17-9-16-5-4-15-3/h7,12-13H,4-6,8-9H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | PCRUZDLBJLONDI-STQMWFEESA-N |
| XLogP | 1.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|