C39H43NO3P2 — CID 101234152
2,6-bis(diphenylphosphorylmethyl)-4-octyl-1-oxidopyridin-1-ium (PubChem CID 101234152) has the molecular formula C39H43NO3P2 and a molecular weight of 635.73 g/mol. Its IUPAC name is 2,6-bis(diphenylphosphorylmethyl)-4-octyl-1-oxidopyridin-1-ium.
| Compound Name | 2,6-bis(diphenylphosphorylmethyl)-4-octyl-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 101234152 |
| Molecular Formula | C39H43NO3P2 |
| Molecular Weight | 635.73 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | 2,6-bis(diphenylphosphorylmethyl)-4-octyl-1-oxidopyridin-1-ium |
| SMILES | CCCCCCCCc1cc(CP(=O)(c2ccccc2)c2ccccc2)[n+]([O-])c(CP(=O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C39H43NO3P2/c1-2-3-4-5-6-11-20-33-29-34(31-44(42,36-21-12-7-13-22-36)37-23-14-8-15-24-37)40(41)35(30-33)32-45(43,38-25-16-9-17-26-38)39-27-18-10-19-28-39/h7-10,12-19,21-30H,2-6,11,20,31-32H2,1H3 |
| InChIKey | NTFYGLWLBMOIAK-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.73 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|