C16H25NO9 — CID 101234160
2-[2-hydroxy-3,4-dimethoxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexen-1-yl]acetonitrile (PubChem CID 101234160) has the molecular formula C16H25NO9 and a molecular weight of 375.37 g/mol. Its IUPAC name is 2-[2-hydroxy-3,4-dimethoxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexen-1-yl]acetonitrile.
| Compound Name | 2-[2-hydroxy-3,4-dimethoxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexen-1-yl]acetonitrile |
|---|---|
| PubChem CID | 101234160 |
| Molecular Formula | C16H25NO9 |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-[2-hydroxy-3,4-dimethoxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexen-1-yl]acetonitrile |
| SMILES | COC1CC(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(CC#N)=C(O)C1OC |
| InChI | InChI=1S/C16H25NO9/c1-23-9-5-8(7(3-4-17)11(19)15(9)24-2)25-16-14(22)13(21)12(20)10(6-18)26-16/h8-10,12-16,18-22H,3,5-6H2,1-2H3/t8?,9?,10-,12-,13+,14-,15?,16-/m1/s1 |
| InChIKey | YFWQJGZYWHRCJF-LSYQBWBXSA-N |
| XLogP | -1.67 |
| TPSA | 161.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |