C16H25NO9 — CID 162968784
(2E)-2-[(2S,3S,4S,6R)-2-hydroxy-3,4-dimethoxy-6-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexylidene]acetonitrile (PubChem CID 162968784) has the molecular formula C16H25NO9 and a molecular weight of 375.37 g/mol. Its IUPAC name is (2E)-2-[(2S,3S,4S,6R)-2-hydroxy-3,4-dimethoxy-6-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexylidene]acetonitrile.
| Compound Name | (2E)-2-[(2S,3S,4S,6R)-2-hydroxy-3,4-dimethoxy-6-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexylidene]acetonitrile |
|---|---|
| PubChem CID | 162968784 |
| Molecular Formula | C16H25NO9 |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (2E)-2-[(2S,3S,4S,6R)-2-hydroxy-3,4-dimethoxy-6-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexylidene]acetonitrile |
| SMILES | CO[C@@H]1[C@@H](OC)C[C@@H](O[C@H]2O[C@@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)/C(=C/C#N)[C@@H]1O |
| InChI | InChI=1S/C16H25NO9/c1-23-9-5-8(7(3-4-17)11(19)15(9)24-2)25-16-14(22)13(21)12(20)10(6-18)26-16/h3,8-16,18-22H,5-6H2,1-2H3/b7-3-/t8-,9+,10+,11+,12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | KURSRHBVYUACKS-PBBKBUMASA-N |
| XLogP | -2.58 |
| TPSA | 161.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|