C25H31NO12 — CID 162924760
[(2R,3R,4S,5S,6R)-2-[(1R,3S,4R,5S)-2-(cyanomethylidene)-3,4-dihydroxy-5-methoxycyclohexyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 162924760) has the molecular formula C25H31NO12 and a molecular weight of 537.52 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-2-[(1R,3S,4R,5S)-2-(cyanomethylidene)-3,4-dihydroxy-5-methoxycyclohexyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3R,4S,5S,6R)-2-[(1R,3S,4R,5S)-2-(cyanomethylidene)-3,4-dihydroxy-5-methoxycyclohexyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162924760 |
| Molecular Formula | C25H31NO12 |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-2-[(1R,3S,4R,5S)-2-(cyanomethylidene)-3,4-dihydroxy-5-methoxycyclohexyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)O[C@H]2[C@H](O[C@@H]3C[C@H](OC)[C@H](O)[C@@H](O)C3=CC#N)O[C@H](CO)[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C25H31NO12/c1-34-16-9-12(3-5-14(16)28)4-6-19(29)38-24-23(33)22(32)18(11-27)37-25(24)36-15-10-17(35-2)21(31)20(30)13(15)7-8-26/h3-7,9,15,17-18,20-25,27-28,30-33H,10-11H2,1-2H3/t15-,17+,18-,20+,21+,22-,23+,24-,25-/m1/s1 |
| InChIKey | RSANRMXIULPPSK-SWNDPNMOSA-N |
| XLogP | -1.26 |
| TPSA | 208.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|