C14H19NO8 — CID 124932700
(2E)-2-[(4S,5S,6S)-4,5-dihydroxy-6-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohex-2-en-1-ylidene]acetonitrile (PubChem CID 124932700) has the molecular formula C14H19NO8 and a molecular weight of 329.31 g/mol. Its IUPAC name is (2E)-2-[(4S,5S,6S)-4,5-dihydroxy-6-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohex-2-en-1-ylidene]acetonitrile.
| Compound Name | (2E)-2-[(4S,5S,6S)-4,5-dihydroxy-6-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohex-2-en-1-ylidene]acetonitrile |
|---|---|
| PubChem CID | 124932700 |
| Molecular Formula | C14H19NO8 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (2E)-2-[(4S,5S,6S)-4,5-dihydroxy-6-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohex-2-en-1-ylidene]acetonitrile |
| SMILES | N#C/C=C1\C=C[C@H](O)[C@H](O)[C@H]1O[C@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19NO8/c15-4-3-6-1-2-7(17)9(18)13(6)23-14-12(21)11(20)10(19)8(5-16)22-14/h1-3,7-14,16-21H,5H2/b6-3+/t7-,8-,9-,10-,11+,12-,13-,14+/m0/s1 |
| InChIKey | WIIDBJNWXCWLKF-CZUJDBBFSA-N |
| XLogP | -3.09 |
| TPSA | 163.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|