C30H31NO11 — CID 101423975
[(1S,2S,3S,4Z,5R)-4-(cyanomethylidene)-2-hydroxy-3-[(E)-3-phenylprop-2-enoyl]oxy-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl] benzoate (PubChem CID 101423975) has the molecular formula C30H31NO11 and a molecular weight of 581.57 g/mol. Its IUPAC name is [(1S,2S,3S,4Z,5R)-4-(cyanomethylidene)-2-hydroxy-3-[(E)-3-phenylprop-2-enoyl]oxy-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl] benzoate.
| Compound Name | [(1S,2S,3S,4Z,5R)-4-(cyanomethylidene)-2-hydroxy-3-[(E)-3-phenylprop-2-enoyl]oxy-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl] benzoate |
|---|---|
| PubChem CID | 101423975 |
| Molecular Formula | C30H31NO11 |
| Molecular Weight | 581.57 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | [(1S,2S,3S,4Z,5R)-4-(cyanomethylidene)-2-hydroxy-3-[(E)-3-phenylprop-2-enoyl]oxy-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl] benzoate |
| SMILES | N#C/C=C1/[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C[C@H](OC(=O)c2ccccc2)[C@H](O)[C@H]1OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C30H31NO11/c31-14-13-19-20(40-30-27(37)26(36)24(34)22(16-32)41-30)15-21(39-29(38)18-9-5-2-6-10-18)25(35)28(19)42-23(33)12-11-17-7-3-1-4-8-17/h1-13,20-22,24-28,30,32,34-37H,15-16H2/b12-11+,19-13-/t20-,21+,22-,24-,25+,26+,27-,28+,30-/m1/s1 |
| InChIKey | IGNLFRDPRQBHRJ-DJPVLMEYSA-N |
| XLogP | 0.24 |
| TPSA | 196.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.57 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|