C14H24O2 — CID 101234482
(2S,3S)-3-ethenyl-2,3,8,8-tetramethyl-6,10-dioxaspiro[4.5]decane (PubChem CID 101234482) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (2S,3S)-3-ethenyl-2,3,8,8-tetramethyl-6,10-dioxaspiro[4.5]decane.
| Compound Name | (2S,3S)-3-ethenyl-2,3,8,8-tetramethyl-6,10-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 101234482 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (2S,3S)-3-ethenyl-2,3,8,8-tetramethyl-6,10-dioxaspiro[4.5]decane |
| SMILES | C=C[C@]1(C)CC2(C[C@@H]1C)OCC(C)(C)CO2 |
| InChI | InChI=1S/C14H24O2/c1-6-13(5)8-14(7-11(13)2)15-9-12(3,4)10-16-14/h6,11H,1,7-10H2,2-5H3/t11-,13+/m0/s1 |
| InChIKey | ZJABUFRVKYGJTE-WCQYABFASA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|