C44H37N7S+4 — CID 10123548
2,7,12,17-tetrakis(1-methylpyridin-1-ium-3-yl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene (PubChem CID 10123548) has the molecular formula C44H37N7S+4 and a molecular weight of 695.90 g/mol. Its IUPAC name is 2,7,12,17-tetrakis(1-methylpyridin-1-ium-3-yl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene.
| Compound Name | 2,7,12,17-tetrakis(1-methylpyridin-1-ium-3-yl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene |
|---|---|
| PubChem CID | 10123548 |
| Molecular Formula | C44H37N7S+4 |
| Molecular Weight | 695.90 g/mol |
| Exact Mass | 695.28 |
| IUPAC Name | 2,7,12,17-tetrakis(1-methylpyridin-1-ium-3-yl)-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene |
| SMILES | C[n+]1cccc(-c2c3nc(c(-c4ccc[n+](C)c4)c4ccc(s4)c(-c4ccc[n+](C)c4)c4nc(c(-c5ccc[n+](C)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C44H37N7S/c1-48-21-5-9-29(25-48)41-33-13-14-34(45-33)42(30-10-6-22-49(2)26-30)36-16-18-38(47-36)44(32-12-8-24-51(4)28-32)40-20-19-39(52-40)43(37-17-15-35(41)46-37)31-11-7-23-50(3)27-31/h5-28,45H,1-4H3/q+4/b41-33-,41-35-,42-34-,42-36-,43-37-,43-39-,44-38-,44-40- |
| InChIKey | ZKLLJYYMDUXHES-JAAFTSFNSA-N |
| XLogP | 7.36 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.90 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|