C13H24O3 — CID 101235915
[(3R,4S)-4-hydroxy-4-methyldec-1-en-3-yl] acetate (PubChem CID 101235915) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is [(3R,4S)-4-hydroxy-4-methyldec-1-en-3-yl] acetate.
| Compound Name | [(3R,4S)-4-hydroxy-4-methyldec-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 101235915 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | [(3R,4S)-4-hydroxy-4-methyldec-1-en-3-yl] acetate |
| SMILES | C=C[C@@H](OC(C)=O)[C@@](C)(O)CCCCCC |
| InChI | InChI=1S/C13H24O3/c1-5-7-8-9-10-13(4,15)12(6-2)16-11(3)14/h6,12,15H,2,5,7-10H2,1,3-4H3/t12-,13+/m1/s1 |
| InChIKey | NTIKMNTZKOVIDP-OLZOCXBDSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|