C48H81NO10P+ — CID 10123646
2-[2,3-bis[[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 10123646) has the molecular formula C48H81NO10P+ and a molecular weight of 863.15 g/mol. Its IUPAC name is 2-[2,3-bis[[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2,3-bis[[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 10123646 |
| Molecular Formula | C48H81NO10P+ |
| Molecular Weight | 863.15 g/mol |
| Exact Mass | 862.56 |
| IUPAC Name | 2-[2,3-bis[[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC[C@H](O)/C=C/C=C\C/C=C\C/C=C\CCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCC/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CCCCC |
| InChI | InChI=1S/C48H80NO10P/c1-6-8-28-34-44(50)36-30-24-20-16-12-10-14-18-22-26-32-38-47(52)56-42-46(43-58-60(54,55)57-41-40-49(3,4)5)59-48(53)39-33-27-23-19-15-11-13-17-21-25-31-37-45(51)35-29-9-7-2/h10-13,18-25,30-31,36-37,44-46,50-51H,6-9,14-17,26-29,32-35,38-43H2,1-5H3/p+1/b12-10-,13-11-,22-18-,23-19-,24-20-,25-21-,36-30+,37-31+/t44-,45-,46?/m0/s1 |
| InChIKey | MCLXLBHVFLIKFZ-VBALBXRSSA-O |
| XLogP | 10.51 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.15 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|