C33H54O2Si2 — CID 101237056
2-[(4R,5R)-2,2-dimethyl-4,5-bis(propa-1,2-dienyl)-5-[2-tri(propan-2-yl)silylethynyl]-1,3-dioxolan-4-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 101237056) has the molecular formula C33H54O2Si2 and a molecular weight of 538.97 g/mol. Its IUPAC name is 2-[(4R,5R)-2,2-dimethyl-4,5-bis(propa-1,2-dienyl)-5-[2-tri(propan-2-yl)silylethynyl]-1,3-dioxolan-4-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[(4R,5R)-2,2-dimethyl-4,5-bis(propa-1,2-dienyl)-5-[2-tri(propan-2-yl)silylethynyl]-1,3-dioxolan-4-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101237056 |
| Molecular Formula | C33H54O2Si2 |
| Molecular Weight | 538.97 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | 2-[(4R,5R)-2,2-dimethyl-4,5-bis(propa-1,2-dienyl)-5-[2-tri(propan-2-yl)silylethynyl]-1,3-dioxolan-4-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | C=C=C[C@]1(C#C[Si](C(C)C)(C(C)C)C(C)C)OC(C)(C)O[C@@]1(C#C[Si](C(C)C)(C(C)C)C(C)C)C=C=C |
| InChI | InChI=1S/C33H54O2Si2/c1-17-19-32(21-23-36(25(3)4,26(5)6)27(7)8)33(20-18-2,35-31(15,16)34-32)22-24-37(28(9)10,29(11)12)30(13)14/h19-20,25-30H,1-2H2,3-16H3/t32-,33-/m1/s1 |
| InChIKey | AOMDILMBBXACLF-CZNDPXEESA-N |
| XLogP | 9.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.97 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|