C33H54O3Si2 — CID 101237058
2-[(4R,5R)-2-ethoxy-4,5-bis(propa-1,2-dienyl)-5-[2-tri(propan-2-yl)silylethynyl]-1,3-dioxolan-4-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 101237058) has the molecular formula C33H54O3Si2 and a molecular weight of 554.96 g/mol. Its IUPAC name is 2-[(4R,5R)-2-ethoxy-4,5-bis(propa-1,2-dienyl)-5-[2-tri(propan-2-yl)silylethynyl]-1,3-dioxolan-4-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[(4R,5R)-2-ethoxy-4,5-bis(propa-1,2-dienyl)-5-[2-tri(propan-2-yl)silylethynyl]-1,3-dioxolan-4-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101237058 |
| Molecular Formula | C33H54O3Si2 |
| Molecular Weight | 554.96 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | 2-[(4R,5R)-2-ethoxy-4,5-bis(propa-1,2-dienyl)-5-[2-tri(propan-2-yl)silylethynyl]-1,3-dioxolan-4-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | C=C=C[C@]1(C#C[Si](C(C)C)(C(C)C)C(C)C)OC(OCC)O[C@@]1(C#C[Si](C(C)C)(C(C)C)C(C)C)C=C=C |
| InChI | InChI=1S/C33H54O3Si2/c1-16-19-32(21-23-37(25(4)5,26(6)7)27(8)9)33(20-17-2,36-31(35-32)34-18-3)22-24-38(28(10)11,29(12)13)30(14)15/h19-20,25-31H,1-2,18H2,3-15H3/t32-,33-/m1/s1 |
| InChIKey | TUJCBWAIFNSXMP-CZNDPXEESA-N |
| XLogP | 8.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.96 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|