C15H18O2 — CID 101239214
7-(but-2-ynoxymethyl)-2,2-dimethyl-3H-1-benzofuran (PubChem CID 101239214) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 7-(but-2-ynoxymethyl)-2,2-dimethyl-3H-1-benzofuran.
| Compound Name | 7-(but-2-ynoxymethyl)-2,2-dimethyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 101239214 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 7-(but-2-ynoxymethyl)-2,2-dimethyl-3H-1-benzofuran |
| SMILES | CC#CCOCc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C15H18O2/c1-4-5-9-16-11-13-8-6-7-12-10-15(2,3)17-14(12)13/h6-8H,9-11H2,1-3H3 |
| InChIKey | WRJYUYMJZRNQJH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|