C15H17N2O4P — CID 101239260
1-[(1R,2R,3R)-3-hydroxy-3-methyl-1-oxo-1-phenyl-1λ5-phospholan-2-yl]pyrimidine-2,4-dione (PubChem CID 101239260) has the molecular formula C15H17N2O4P and a molecular weight of 320.29 g/mol. Its IUPAC name is 1-[(1R,2R,3R)-3-hydroxy-3-methyl-1-oxo-1-phenyl-1λ5-phospholan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,2R,3R)-3-hydroxy-3-methyl-1-oxo-1-phenyl-1λ5-phospholan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101239260 |
| Molecular Formula | C15H17N2O4P |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-[(1R,2R,3R)-3-hydroxy-3-methyl-1-oxo-1-phenyl-1λ5-phospholan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@@]1(O)CC[P@@](=O)(c2ccccc2)[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C15H17N2O4P/c1-15(20)8-10-22(21,11-5-3-2-4-6-11)13(15)17-9-7-12(18)16-14(17)19/h2-7,9,13,20H,8,10H2,1H3,(H,16,18,19)/t13-,15-,22-/m1/s1 |
| InChIKey | BTQPAHGCFSUQSS-DZKLMBRESA-N |
| XLogP | 0.88 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|