C17H17N2O8P — CID 163789144
1-[(6R)-7-hydroxy-7-methyl-2-oxo-2-phenoxy-6,8-dihydro-4H-pyrano[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione (PubChem CID 163789144) has the molecular formula C17H17N2O8P and a molecular weight of 408.30 g/mol. Its IUPAC name is 1-[(6R)-7-hydroxy-7-methyl-2-oxo-2-phenoxy-6,8-dihydro-4H-pyrano[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(6R)-7-hydroxy-7-methyl-2-oxo-2-phenoxy-6,8-dihydro-4H-pyrano[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163789144 |
| Molecular Formula | C17H17N2O8P |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 1-[(6R)-7-hydroxy-7-methyl-2-oxo-2-phenoxy-6,8-dihydro-4H-pyrano[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione |
| SMILES | CC1(O)CC2=C(COP(=O)(Oc3ccccc3)O2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C17H17N2O8P/c1-17(22)9-12-13(25-15(17)19-8-7-14(20)18-16(19)21)10-24-28(23,27-12)26-11-5-3-2-4-6-11/h2-8,15,22H,9-10H2,1H3,(H,18,20,21)/t15-,17?,28?/m1/s1 |
| InChIKey | MVEBJRSWIZJWEU-SDLXZWLTSA-N |
| XLogP | 1.65 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|