C17H21N2O6P — CID 163543710
1-[(2R,5S)-5-methyl-5-[[methyl(phenoxy)phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 163543710) has the molecular formula C17H21N2O6P and a molecular weight of 380.34 g/mol. Its IUPAC name is 1-[(2R,5S)-5-methyl-5-[[methyl(phenoxy)phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-methyl-5-[[methyl(phenoxy)phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163543710 |
| Molecular Formula | C17H21N2O6P |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[(2R,5S)-5-methyl-5-[[methyl(phenoxy)phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@@]1(COP(C)(=O)Oc2ccccc2)CC[C@H](n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C17H21N2O6P/c1-17(12-23-26(2,22)25-13-6-4-3-5-7-13)10-8-15(24-17)19-11-9-14(20)18-16(19)21/h3-7,9,11,15H,8,10,12H2,1-2H3,(H,18,20,21)/t15-,17+,26?/m1/s1 |
| InChIKey | FDFQGGVYSMLKSP-VETPBDLOSA-N |
| XLogP | 2.52 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|