C12H13N3O5 — CID 67875666
[(2S,5S)-2-cyano-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 67875666) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is [(2S,5S)-2-cyano-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,5S)-2-cyano-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67875666 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [(2S,5S)-2-cyano-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C#N)CC[C@@H](n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C12H13N3O5/c1-8(16)19-7-12(6-13)4-2-10(20-12)15-5-3-9(17)14-11(15)18/h3,5,10H,2,4,7H2,1H3,(H,14,17,18)/t10-,12-/m0/s1 |
| InChIKey | DIYZVYAKDZRKSA-JQWIXIFHSA-N |
| XLogP | -0.33 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |