C21H30N2O7Si — CID 22451313
[3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-2-(2-triethylsilylethynyl)oxolan-2-yl]methyl acetate (PubChem CID 22451313) has the molecular formula C21H30N2O7Si and a molecular weight of 450.56 g/mol. Its IUPAC name is [3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-2-(2-triethylsilylethynyl)oxolan-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-2-(2-triethylsilylethynyl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22451313 |
| Molecular Formula | C21H30N2O7Si |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-2-(2-triethylsilylethynyl)oxolan-2-yl]methyl acetate |
| SMILES | CC[Si](C#CC1(COC(C)=O)OC(n2ccc(=O)[nH]c2=O)CC1OC(C)=O)(CC)CC |
| InChI | InChI=1S/C21H30N2O7Si/c1-6-31(7-2,8-3)12-10-21(14-28-15(4)24)17(29-16(5)25)13-19(30-21)23-11-9-18(26)22-20(23)27/h9,11,17,19H,6-8,13-14H2,1-5H3,(H,22,26,27) |
| InChIKey | BZECBGMWCDEPCC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|