C23H33BrN2O7Si — CID 10578731
[(2R,3R,4R,5R)-3-acetyloxy-4-bromo-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(2-triethylsilylethynyl)oxolan-2-yl]methyl acetate (PubChem CID 10578731) has the molecular formula C23H33BrN2O7Si and a molecular weight of 557.51 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3-acetyloxy-4-bromo-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(2-triethylsilylethynyl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3-acetyloxy-4-bromo-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(2-triethylsilylethynyl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10578731 |
| Molecular Formula | C23H33BrN2O7Si |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | [(2R,3R,4R,5R)-3-acetyloxy-4-bromo-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(2-triethylsilylethynyl)oxolan-2-yl]methyl acetate |
| SMILES | CCc1cn([C@@H]2O[C@](C#C[Si](CC)(CC)CC)(COC(C)=O)[C@@H](OC(C)=O)[C@H]2Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H33BrN2O7Si/c1-7-17-13-26(22(30)25-20(17)29)21-18(24)19(32-16(6)28)23(33-21,14-31-15(5)27)11-12-34(8-2,9-3)10-4/h13,18-19,21H,7-10,14H2,1-6H3,(H,25,29,30)/t18-,19+,21-,23-/m1/s1 |
| InChIKey | UPHIVLLSTCVKEW-MHXAIHSWSA-N |
| XLogP | 2.68 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|