C39H44N2O7SSi — CID 10676307
5-methyl-1-[(2R,3R,4S,5R)-3-phenoxycarbothioyloxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10676307) has the molecular formula C39H44N2O7SSi and a molecular weight of 712.94 g/mol. Its IUPAC name is 5-methyl-1-[(2R,3R,4S,5R)-3-phenoxycarbothioyloxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(2R,3R,4S,5R)-3-phenoxycarbothioyloxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10676307 |
| Molecular Formula | C39H44N2O7SSi |
| Molecular Weight | 712.94 g/mol |
| Exact Mass | 712.26 |
| IUPAC Name | 5-methyl-1-[(2R,3R,4S,5R)-3-phenoxycarbothioyloxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC[Si](C#C[C@]1(COCc2ccccc2)O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](OC(=S)Oc2ccccc2)[C@@H]1OCc1ccccc1)(CC)CC |
| InChI | InChI=1S/C39H44N2O7SSi/c1-5-50(6-2,7-3)24-23-39(28-44-26-30-17-11-8-12-18-30)34(45-27-31-19-13-9-14-20-31)33(47-38(49)46-32-21-15-10-16-22-32)36(48-39)41-25-29(4)35(42)40-37(41)43/h8-22,25,33-34,36H,5-7,26-28H2,1-4H3,(H,40,42,43)/t33-,34+,36-,39-/m1/s1 |
| InChIKey | DXFRJQJQNHWYQK-NDZWSBILSA-N |
| XLogP | 6.72 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.94 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|