C27H36O5Si — CID 174060756
(3R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolane-2,3-diol (PubChem CID 174060756) has the molecular formula C27H36O5Si and a molecular weight of 468.67 g/mol. Its IUPAC name is (3R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolane-2,3-diol.
| Compound Name | (3R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolane-2,3-diol |
|---|---|
| PubChem CID | 174060756 |
| Molecular Formula | C27H36O5Si |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (3R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolane-2,3-diol |
| SMILES | CC[Si](C#C[C@]1(COCc2ccccc2)OC(O)[C@H](O)[C@@H]1OCc1ccccc1)(CC)CC |
| InChI | InChI=1S/C27H36O5Si/c1-4-33(5-2,6-3)18-17-27(21-30-19-22-13-9-7-10-14-22)25(24(28)26(29)32-27)31-20-23-15-11-8-12-16-23/h7-16,24-26,28-29H,4-6,19-21H2,1-3H3/t24-,25+,26?,27-/m1/s1 |
| InChIKey | AUIVECIHLKGQIU-RIFKGGETSA-N |
| XLogP | 4.29 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|