C34H42N2O7Si — CID 175067753
(2R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(3R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolan-3-yl]acetic acid (PubChem CID 175067753) has the molecular formula C34H42N2O7Si and a molecular weight of 618.80 g/mol. Its IUPAC name is (2R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(3R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolan-3-yl]acetic acid.
| Compound Name | (2R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(3R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 175067753 |
| Molecular Formula | C34H42N2O7Si |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | (2R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(3R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-5-(2-triethylsilylethynyl)oxolan-3-yl]acetic acid |
| SMILES | CC[Si](C#C[C@]1(COCc2ccccc2)OC[C@@H]([C@H](C(=O)O)n2cc(C)c(=O)[nH]c2=O)[C@@H]1OCc1ccccc1)(CC)CC |
| InChI | InChI=1S/C34H42N2O7Si/c1-5-44(6-2,7-3)19-18-34(24-41-21-26-14-10-8-11-15-26)30(42-22-27-16-12-9-13-17-27)28(23-43-34)29(32(38)39)36-20-25(4)31(37)35-33(36)40/h8-17,20,28-30H,5-7,21-24H2,1-4H3,(H,38,39)(H,35,37,40)/t28-,29+,30-,34+/m0/s1 |
| InChIKey | LXOFKYOGIOEVTK-CTMYTVLESA-N |
| XLogP | 4.71 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|