C26H28N2O8 — CID 175677847
1-[(2S,3S,4S,5R)-5-acetyl-2,3-dihydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 175677847) has the molecular formula C26H28N2O8 and a molecular weight of 496.52 g/mol. Its IUPAC name is 1-[(2S,3S,4S,5R)-5-acetyl-2,3-dihydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3S,4S,5R)-5-acetyl-2,3-dihydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175677847 |
| Molecular Formula | C26H28N2O8 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 1-[(2S,3S,4S,5R)-5-acetyl-2,3-dihydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC(=O)[C@]1(COCc2ccccc2)O[C@](O)(n2cc(C)c(=O)[nH]c2=O)[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H28N2O8/c1-17-13-28(24(32)27-23(17)31)26(33)21(30)22(35-15-20-11-7-4-8-12-20)25(36-26,18(2)29)16-34-14-19-9-5-3-6-10-19/h3-13,21-22,30,33H,14-16H2,1-2H3,(H,27,31,32)/t21-,22-,25-,26-/m0/s1 |
| InChIKey | BZSVYJQJOQKOPH-JPMIEVGJSA-N |
| XLogP | 0.97 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |