C21H26N2O7 — CID 11538973
1-[(3aR,4R,6R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 11538973) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11538973 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@]2(CO)O[C@H](COCc3ccccc3)[C@H]3OC(C)(C)O[C@H]32)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H26N2O7/c1-13-9-23(19(26)22-18(13)25)21(12-24)17-16(29-20(2,3)30-17)15(28-21)11-27-10-14-7-5-4-6-8-14/h4-9,15-17,24H,10-12H2,1-3H3,(H,22,25,26)/t15-,16-,17-,21-/m1/s1 |
| InChIKey | IHGWKJRLHZGBFN-BZLDKRAPSA-N |
| XLogP | 0.63 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |