C28H26FN5O5 — CID 175068279
(2R)-2-(6-amino-2-fluoropurin-9-yl)-2-[(3R,4S,5R)-5-ethynyl-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]acetic acid (PubChem CID 175068279) has the molecular formula C28H26FN5O5 and a molecular weight of 531.54 g/mol. Its IUPAC name is (2R)-2-(6-amino-2-fluoropurin-9-yl)-2-[(3R,4S,5R)-5-ethynyl-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]acetic acid.
| Compound Name | (2R)-2-(6-amino-2-fluoropurin-9-yl)-2-[(3R,4S,5R)-5-ethynyl-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 175068279 |
| Molecular Formula | C28H26FN5O5 |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | (2R)-2-(6-amino-2-fluoropurin-9-yl)-2-[(3R,4S,5R)-5-ethynyl-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]acetic acid |
| SMILES | C#C[C@]1(COCc2ccccc2)OC[C@@H]([C@H](C(=O)O)n2cnc3c(N)nc(F)nc32)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H26FN5O5/c1-2-28(16-37-13-18-9-5-3-6-10-18)23(38-14-19-11-7-4-8-12-19)20(15-39-28)22(26(35)36)34-17-31-21-24(30)32-27(29)33-25(21)34/h1,3-12,17,20,22-23H,13-16H2,(H,35,36)(H2,30,32,33)/t20-,22+,23-,28+/m0/s1 |
| InChIKey | LFJRUJOVMOMGNJ-CRQKQFHESA-N |
| XLogP | 2.99 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|