C12H19BrO2Si — CID 101239882
(1R)-2-bromo-1-[(1R)-1-hydroxy-3-trimethylsilylprop-2-ynyl]cyclohex-2-en-1-ol (PubChem CID 101239882) has the molecular formula C12H19BrO2Si and a molecular weight of 303.27 g/mol. Its IUPAC name is (1R)-2-bromo-1-[(1R)-1-hydroxy-3-trimethylsilylprop-2-ynyl]cyclohex-2-en-1-ol.
| Compound Name | (1R)-2-bromo-1-[(1R)-1-hydroxy-3-trimethylsilylprop-2-ynyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 101239882 |
| Molecular Formula | C12H19BrO2Si |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | (1R)-2-bromo-1-[(1R)-1-hydroxy-3-trimethylsilylprop-2-ynyl]cyclohex-2-en-1-ol |
| SMILES | C[Si](C)(C)C#C[C@@H](O)[C@]1(O)CCCC=C1Br |
| InChI | InChI=1S/C12H19BrO2Si/c1-16(2,3)9-7-11(14)12(15)8-5-4-6-10(12)13/h6,11,14-15H,4-5,8H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | QHHHMNBYYKEORA-NEPJUHHUSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|