C18H19NOS — CID 101239971
(6S)-4,6-dibenzylthiomorpholin-3-one (PubChem CID 101239971) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is (6S)-4,6-dibenzylthiomorpholin-3-one.
| Compound Name | (6S)-4,6-dibenzylthiomorpholin-3-one |
|---|---|
| PubChem CID | 101239971 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (6S)-4,6-dibenzylthiomorpholin-3-one |
| SMILES | O=C1CS[C@@H](Cc2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C18H19NOS/c20-18-14-21-17(11-15-7-3-1-4-8-15)13-19(18)12-16-9-5-2-6-10-16/h1-10,17H,11-14H2/t17-/m0/s1 |
| InChIKey | MTPDLLGLJBVIIL-KRWDZBQOSA-N |
| XLogP | 3.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |