C14H20OSi — CID 101241774
trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane (PubChem CID 101241774) has the molecular formula C14H20OSi and a molecular weight of 232.40 g/mol. Its IUPAC name is trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane.
| Compound Name | trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane |
|---|---|
| PubChem CID | 101241774 |
| Molecular Formula | C14H20OSi |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane |
| SMILES | Cc1ccc([C@@H]2O[C@@H]2/C=C/[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C14H20OSi/c1-11-5-7-12(8-6-11)14-13(15-14)9-10-16(2,3)4/h5-10,13-14H,1-4H3/b10-9+/t13-,14+/m1/s1 |
| InChIKey | KWYZBPDVIBTKIV-HOQBHHMFSA-N |
| XLogP | 3.87 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|