About trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane
trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane (PubChem CID 101241774) has the molecular formula C14H20OSi
and a molecular weight of 232.40 g/mol. Its IUPAC name is trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane |
| PubChem CID | 101241774 |
| Molecular Formula | C14H20OSi |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane |
| SMILES | Cc1ccc([C@@H]2O[C@@H]2/C=C/[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C14H20OSi/c1-11-5-7-12(8-6-11)14-13(15-14)9-10-16(2,3)4/h5-10,13-14H,1-4H3/b10-9+/t13-,14+/m1/s1 |
| InChIKey | KWYZBPDVIBTKIV-HOQBHHMFSA-N |
| XLogP | 3.87 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane?
The IUPAC name of trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane (CID 101241774) is trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane.
What is the SMILES notation for trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane?
The canonical SMILES for trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane is Cc1ccc([C@@H]2O[C@@H]2/C=C/[Si](C)(C)C)cc1.
What is the InChIKey of trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane?
The InChIKey is KWYZBPDVIBTKIV-HOQBHHMFSA-N. The full InChI is InChI=1S/C14H20OSi/c1-11-5-7-12(8-6-11)14-13(15-14)9-10-16(2,3)4/h5-10,13-14H,1-4H3/b10-9+/t13-,14+/m1/s1.
What are the key properties of trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane?
trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane has a molecular weight of 232.40 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(E)-2-[(2R,3S)-3-(4-methylphenyl)oxiran-2-yl]ethenyl]silane is sourced from PubChem (CID 101241774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).