C14H15NO2S — CID 101242566
methyl (E)-2-methyl-3-[(4S)-2-phenyl-4,5-dihydro-1,3-thiazol-4-yl]prop-2-enoate (PubChem CID 101242566) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is methyl (E)-2-methyl-3-[(4S)-2-phenyl-4,5-dihydro-1,3-thiazol-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-2-methyl-3-[(4S)-2-phenyl-4,5-dihydro-1,3-thiazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101242566 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | methyl (E)-2-methyl-3-[(4S)-2-phenyl-4,5-dihydro-1,3-thiazol-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C(C)=C/[C@H]1CSC(c2ccccc2)=N1 |
| InChI | InChI=1S/C14H15NO2S/c1-10(14(16)17-2)8-12-9-18-13(15-12)11-6-4-3-5-7-11/h3-8,12H,9H2,1-2H3/b10-8+/t12-/m0/s1 |
| InChIKey | JBYHKYMYGGQPKM-OANVXVOSSA-N |
| XLogP | 2.67 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|