C15H14NO2 — CID 101242759
CID 101242759 (PubChem CID 101242759) has the molecular formula C15H14NO2 and a molecular weight of 240.28 g/mol.
| Compound Name | CID 101242759 |
|---|---|
| PubChem CID | 101242759 |
| Molecular Formula | C15H14NO2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | — |
| SMILES | [O]C1=C=Cc2cc3c4c(c2O1)CCCN4CCC3 |
| InChI | InChI=1S/C15H14NO2/c17-13-6-5-11-9-10-3-1-7-16-8-2-4-12(14(10)16)15(11)18-13/h5,9H,1-4,7-8H2 |
| InChIKey | HLXBGEKWIKWQKC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|