C27H42O5 — CID 101243407
ethyl (3aR,5S,6R,8aR,9R,9aS)-5-[(2R)-but-3-en-2-yl]-5-hydroxy-2,2,8a-trimethyl-9-propan-2-yl-6-prop-2-enyl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate (PubChem CID 101243407) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is ethyl (3aR,5S,6R,8aR,9R,9aS)-5-[(2R)-but-3-en-2-yl]-5-hydroxy-2,2,8a-trimethyl-9-propan-2-yl-6-prop-2-enyl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate.
| Compound Name | ethyl (3aR,5S,6R,8aR,9R,9aS)-5-[(2R)-but-3-en-2-yl]-5-hydroxy-2,2,8a-trimethyl-9-propan-2-yl-6-prop-2-enyl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate |
|---|---|
| PubChem CID | 101243407 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | ethyl (3aR,5S,6R,8aR,9R,9aS)-5-[(2R)-but-3-en-2-yl]-5-hydroxy-2,2,8a-trimethyl-9-propan-2-yl-6-prop-2-enyl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OCC)CC[C@@]2(C)C(=C[C@@]1(O)[C@H](C)C=C)[C@H]1OC(C)(C)O[C@H]1[C@@H]2C(C)C |
| InChI | InChI=1S/C27H42O5/c1-10-13-26(23(28)30-12-3)15-14-25(9)19(16-27(26,29)18(6)11-2)21-22(20(25)17(4)5)32-24(7,8)31-21/h10-11,16-18,20-22,29H,1-2,12-15H2,3-9H3/t18-,20+,21-,22+,25+,26-,27-/m1/s1 |
| InChIKey | PTFMYYJHVGSBTB-CPEXTGBKSA-N |
| XLogP | 5.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|