C31H52O6Si — CID 11541236
ethyl (E)-5-[(3aR,5S,6R,8aR,9R,9aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8a-tetramethyl-9-propan-2-yl-3a,5,7,8,9,9a-hexahydroazuleno[1,2-d][1,3]dioxol-6-yl]-3-oxopent-4-enoate (PubChem CID 11541236) has the molecular formula C31H52O6Si and a molecular weight of 548.84 g/mol. Its IUPAC name is ethyl (E)-5-[(3aR,5S,6R,8aR,9R,9aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8a-tetramethyl-9-propan-2-yl-3a,5,7,8,9,9a-hexahydroazuleno[1,2-d][1,3]dioxol-6-yl]-3-oxopent-4-enoate.
| Compound Name | ethyl (E)-5-[(3aR,5S,6R,8aR,9R,9aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8a-tetramethyl-9-propan-2-yl-3a,5,7,8,9,9a-hexahydroazuleno[1,2-d][1,3]dioxol-6-yl]-3-oxopent-4-enoate |
|---|---|
| PubChem CID | 11541236 |
| Molecular Formula | C31H52O6Si |
| Molecular Weight | 548.84 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | ethyl (E)-5-[(3aR,5S,6R,8aR,9R,9aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8a-tetramethyl-9-propan-2-yl-3a,5,7,8,9,9a-hexahydroazuleno[1,2-d][1,3]dioxol-6-yl]-3-oxopent-4-enoate |
| SMILES | CCOC(=O)CC(=O)/C=C/[C@@]1(C)CC[C@@]2(C)C(=C[C@@H]1O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@H]1[C@@H]2C(C)C |
| InChI | InChI=1S/C31H52O6Si/c1-13-34-24(33)18-21(32)14-15-30(9)16-17-31(10)22(19-23(30)37-38(11,12)28(4,5)6)26-27(25(31)20(2)3)36-29(7,8)35-26/h14-15,19-20,23,25-27H,13,16-18H2,1-12H3/b15-14+/t23-,25-,26+,27-,30-,31-/m0/s1 |
| InChIKey | WWTSBCRNLGJVKB-QVNFZEBOSA-N |
| XLogP | 6.99 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.84 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|