C50H56N4O5 — CID 101244575
N-[1,7-bis(phenylmethoxy)-4-(3-phenylmethoxypropyl)heptan-4-yl]-4-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]butanamide (PubChem CID 101244575) has the molecular formula C50H56N4O5 and a molecular weight of 793.02 g/mol. Its IUPAC name is N-[1,7-bis(phenylmethoxy)-4-(3-phenylmethoxypropyl)heptan-4-yl]-4-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]butanamide.
| Compound Name | N-[1,7-bis(phenylmethoxy)-4-(3-phenylmethoxypropyl)heptan-4-yl]-4-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]butanamide |
|---|---|
| PubChem CID | 101244575 |
| Molecular Formula | C50H56N4O5 |
| Molecular Weight | 793.02 g/mol |
| Exact Mass | 792.43 |
| IUPAC Name | N-[1,7-bis(phenylmethoxy)-4-(3-phenylmethoxypropyl)heptan-4-yl]-4-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]butanamide |
| SMILES | O=C(CCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1)NC(CCCOCc1ccccc1)(CCCOCc1ccccc1)CCCOCc1ccccc1 |
| InChI | InChI=1S/C50H56N4O5/c55-49(26-14-35-59-44-36-47(45-24-10-12-30-51-45)53-48(37-44)46-25-11-13-31-52-46)54-50(27-15-32-56-38-41-18-4-1-5-19-41,28-16-33-57-39-42-20-6-2-7-21-42)29-17-34-58-40-43-22-8-3-9-23-43/h1-13,18-25,30-31,36-37H,14-17,26-29,32-35,38-40H2,(H,54,55) |
| InChIKey | UWTMLTYHHLMDPK-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.02 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|