C28H34OS2 — CID 101245223
1-[7-[(4S)-4-methylhexyl]-[1]benzothiolo[3,2-b][1]benzothiol-2-yl]heptan-1-one (PubChem CID 101245223) has the molecular formula C28H34OS2 and a molecular weight of 450.71 g/mol. Its IUPAC name is 1-[7-[(4S)-4-methylhexyl]-[1]benzothiolo[3,2-b][1]benzothiol-2-yl]heptan-1-one.
| Compound Name | 1-[7-[(4S)-4-methylhexyl]-[1]benzothiolo[3,2-b][1]benzothiol-2-yl]heptan-1-one |
|---|---|
| PubChem CID | 101245223 |
| Molecular Formula | C28H34OS2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 1-[7-[(4S)-4-methylhexyl]-[1]benzothiolo[3,2-b][1]benzothiol-2-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)c1ccc2c(c1)sc1c3ccc(CCC[C@@H](C)CC)cc3sc21 |
| InChI | InChI=1S/C28H34OS2/c1-4-6-7-8-12-24(29)21-14-16-23-26(18-21)31-27-22-15-13-20(11-9-10-19(3)5-2)17-25(22)30-28(23)27/h13-19H,4-12H2,1-3H3/t19-/m0/s1 |
| InChIKey | XQQJGWZHLOXOSZ-IBGZPJMESA-N |
| XLogP | 9.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|