About (1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one
(1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one (PubChem CID 101246909) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is (1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one.
Analyze (1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one?
The IUPAC name of (1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one (CID 101246909) is (1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one.
What is the SMILES notation for (1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one?
The canonical SMILES for (1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one is C[C@]12OCC[C@H](CC1=O)O2.
What is the InChIKey of (1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one?
The InChIKey is YFLMYZJNUZCHHO-IYSWYEEDSA-N. The full InChI is InChI=1S/C7H10O3/c1-7-6(8)4-5(10-7)2-3-9-7/h5H,2-4H2,1H3/t5-,7-/m1/s1.
What are the key properties of (1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one?
(1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one has a molecular weight of 142.15 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5R)-1-methyl-2,8-dioxabicyclo[3.2.1]octan-7-one is sourced from PubChem (CID 101246909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).