C10H12O5 — CID 135023986
(1R,2R,4S,7R,10S)-3,8,13,14-tetraoxatetracyclo[8.3.1.01,7.02,4]tetradecan-5-one (PubChem CID 135023986) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is (1R,2R,4S,7R,10S)-3,8,13,14-tetraoxatetracyclo[8.3.1.01,7.02,4]tetradecan-5-one.
| Compound Name | (1R,2R,4S,7R,10S)-3,8,13,14-tetraoxatetracyclo[8.3.1.01,7.02,4]tetradecan-5-one |
|---|---|
| PubChem CID | 135023986 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (1R,2R,4S,7R,10S)-3,8,13,14-tetraoxatetracyclo[8.3.1.01,7.02,4]tetradecan-5-one |
| SMILES | O=C1C[C@H]2OC[C@@H]3CCO[C@]2(O3)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C10H12O5/c11-6-3-7-10(9-8(6)14-9)13-2-1-5(15-10)4-12-7/h5,7-9H,1-4H2/t5-,7+,8+,9+,10+/m0/s1 |
| InChIKey | JRBIMGPEVWIVCN-BOHATCBPSA-N |
| XLogP | -0.37 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|