C10H14O4 — CID 135042099
(1S,4S,6R,9S)-7,12,13-trioxatricyclo[7.3.1.01,6]tridec-2-en-4-ol (PubChem CID 135042099) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (1S,4S,6R,9S)-7,12,13-trioxatricyclo[7.3.1.01,6]tridec-2-en-4-ol.
| Compound Name | (1S,4S,6R,9S)-7,12,13-trioxatricyclo[7.3.1.01,6]tridec-2-en-4-ol |
|---|---|
| PubChem CID | 135042099 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (1S,4S,6R,9S)-7,12,13-trioxatricyclo[7.3.1.01,6]tridec-2-en-4-ol |
| SMILES | O[C@@H]1C=C[C@@]23OCC[C@@H](CO[C@@H]2C1)O3 |
| InChI | InChI=1S/C10H14O4/c11-7-1-3-10-9(5-7)12-6-8(14-10)2-4-13-10/h1,3,7-9,11H,2,4-6H2/t7-,8+,9-,10+/m1/s1 |
| InChIKey | ZJUPVHCCLOQEBE-RGOKHQFPSA-N |
| XLogP | 0.21 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|