C8H12O3 — CID 44567078
(3aR,7aR)-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a,6-diol (PubChem CID 44567078) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (3aR,7aR)-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a,6-diol.
| Compound Name | (3aR,7aR)-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a,6-diol |
|---|---|
| PubChem CID | 44567078 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (3aR,7aR)-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a,6-diol |
| SMILES | OC1C=C[C@]2(O)CCO[C@@H]2C1 |
| InChI | InChI=1S/C8H12O3/c9-6-1-2-8(10)3-4-11-7(8)5-6/h1-2,6-7,9-10H,3-5H2/t6?,7-,8+/m1/s1 |
| InChIKey | SWUWGVKRMOEGEN-VVXQKDJTSA-N |
| XLogP | -0.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|