C8H12O3 — CID 135040721
2,6,9-trioxatricyclo[6.3.0.01,5]undecane (PubChem CID 135040721) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2,6,9-trioxatricyclo[6.3.0.01,5]undecane.
| Compound Name | 2,6,9-trioxatricyclo[6.3.0.01,5]undecane |
|---|---|
| PubChem CID | 135040721 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2,6,9-trioxatricyclo[6.3.0.01,5]undecane |
| SMILES | C1CC23OCCC2OCC3O1 |
| InChI | InChI=1S/C8H12O3/c1-3-11-8-2-4-9-7(8)5-10-6(1)8/h6-7H,1-5H2 |
| InChIKey | PAIPDVUKTQIVSZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |