C11H18O3 — CID 73120868
9-methyl-8,12-dioxatricyclo[7.2.1.01,6]dodecan-10-ol (PubChem CID 73120868) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 9-methyl-8,12-dioxatricyclo[7.2.1.01,6]dodecan-10-ol.
| Compound Name | 9-methyl-8,12-dioxatricyclo[7.2.1.01,6]dodecan-10-ol |
|---|---|
| PubChem CID | 73120868 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 9-methyl-8,12-dioxatricyclo[7.2.1.01,6]dodecan-10-ol |
| SMILES | CC12OCC3CCCCC3(CC1O)O2 |
| InChI | InChI=1S/C11H18O3/c1-10-9(12)6-11(14-10)5-3-2-4-8(11)7-13-10/h8-9,12H,2-7H2,1H3 |
| InChIKey | SJTGVJPDRXRVPI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |